C20H32N4 — CID 138648643
N-[4-[[(Z)-3-(7-aminocyclohepta-1,4,6-trien-1-yl)pent-3-enyl]amino]but-2-enyl]-N-ethyl-N'-methylmethanimidamide (PubChem CID 138648643) has the molecular formula C20H32N4 and a molecular weight of 328.50 g/mol. Its IUPAC name is N-[4-[[(Z)-3-(7-aminocyclohepta-1,4,6-trien-1-yl)pent-3-enyl]amino]but-2-enyl]-N-ethyl-N'-methylmethanimidamide.
| Compound Name | N-[4-[[(Z)-3-(7-aminocyclohepta-1,4,6-trien-1-yl)pent-3-enyl]amino]but-2-enyl]-N-ethyl-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 138648643 |
| Molecular Formula | C20H32N4 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | N-[4-[[(Z)-3-(7-aminocyclohepta-1,4,6-trien-1-yl)pent-3-enyl]amino]but-2-enyl]-N-ethyl-N'-methylmethanimidamide |
| SMILES | C/C=C(/CCNCC=CCN(/C=N/C)CC)C1=CCC=CC=C1N |
| InChI | InChI=1S/C20H32N4/c1-4-18(19-11-7-6-8-12-20(19)21)13-15-23-14-9-10-16-24(5-2)17-22-3/h4,6,8-12,17,23H,5,7,13-16,21H2,1-3H3/b10-9?,18-4-,22-17+ |
| InChIKey | YORPBSSETWWSHV-GVNWBFGQSA-N |
| XLogP | 3.18 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|