About N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine
N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine (PubChem CID 138649007) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine |
| PubChem CID | 138649007 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine |
| SMILES | C/C=C(\NCCN)N1CCN=C1CC |
| InChI | InChI=1S/C10H20N4/c1-3-9(12-6-5-11)14-8-7-13-10(14)4-2/h3,12H,4-8,11H2,1-2H3/b9-3+ |
| InChIKey | ZPPSJAPEHJIUJL-YCRREMRBSA-N |
| XLogP | 0.52 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine?
The IUPAC name of N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine (CID 138649007) is N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine?
The canonical SMILES for N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine is C/C=C(\NCCN)N1CCN=C1CC.
What is the InChIKey of N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine?
The InChIKey is ZPPSJAPEHJIUJL-YCRREMRBSA-N. The full InChI is InChI=1S/C10H20N4/c1-3-9(12-6-5-11)14-8-7-13-10(14)4-2/h3,12H,4-8,11H2,1-2H3/b9-3+.
What are the key properties of N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine?
N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine has a molecular weight of 196.30 g/mol, XLogP of 0.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-1-(2-ethyl-4,5-dihydroimidazol-1-yl)prop-1-enyl]ethane-1,2-diamine is sourced from PubChem (CID 138649007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).