About 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole
4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole (PubChem CID 138649012) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole.
Molecular Properties
| Compound Name | 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole |
| PubChem CID | 138649012 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole |
| SMILES | C=CC(=C)C1=CC(CCCC)N=C1 |
| InChI | InChI=1S/C12H17N/c1-4-6-7-12-8-11(9-13-12)10(3)5-2/h5,8-9,12H,2-4,6-7H2,1H3 |
| InChIKey | HSZSJGRBAJGLFY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole?
The IUPAC name of 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole (CID 138649012) is 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole.
What is the SMILES notation for 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole?
The canonical SMILES for 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole is C=CC(=C)C1=CC(CCCC)N=C1.
What is the InChIKey of 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole?
The InChIKey is HSZSJGRBAJGLFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-4-6-7-12-8-11(9-13-12)10(3)5-2/h5,8-9,12H,2-4,6-7H2,1H3.
What are the key properties of 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole?
4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole has a molecular weight of 175.27 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-buta-1,3-dien-2-yl-2-butyl-2H-pyrrole is sourced from PubChem (CID 138649012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).