C19H25N — CID 138649338
(2E,3E)-N-(4,7-dimethylcyclohepta-1,3,6-trien-1-yl)-2,3-di(ethylidene)hex-5-en-1-imine (PubChem CID 138649338) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is (2E,3E)-N-(4,7-dimethylcyclohepta-1,3,6-trien-1-yl)-2,3-di(ethylidene)hex-5-en-1-imine.
| Compound Name | (2E,3E)-N-(4,7-dimethylcyclohepta-1,3,6-trien-1-yl)-2,3-di(ethylidene)hex-5-en-1-imine |
|---|---|
| PubChem CID | 138649338 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (2E,3E)-N-(4,7-dimethylcyclohepta-1,3,6-trien-1-yl)-2,3-di(ethylidene)hex-5-en-1-imine |
| SMILES | C=CCC(=C\C)/C(/C=N/C1=CC=C(C)CC=C1C)=C\C |
| InChI | InChI=1S/C19H25N/c1-6-9-17(7-2)18(8-3)14-20-19-13-11-15(4)10-12-16(19)5/h6-8,11-14H,1,9-10H2,2-5H3/b17-7+,18-8-,20-14+ |
| InChIKey | JUBJDDMVFRLRAJ-ZZWOIZRPSA-N |
| XLogP | 5.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|