C19H22N2 — CID 138649348
(2E)-3-N-[(1E,3Z)-8-ethenyl-3-methylcycloocta-1,3-dien-6-yn-1-yl]-2-ethylidene-1-N-methylpent-4-ene-1,3-diimine (PubChem CID 138649348) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (2E)-3-N-[(1E,3Z)-8-ethenyl-3-methylcycloocta-1,3-dien-6-yn-1-yl]-2-ethylidene-1-N-methylpent-4-ene-1,3-diimine.
| Compound Name | (2E)-3-N-[(1E,3Z)-8-ethenyl-3-methylcycloocta-1,3-dien-6-yn-1-yl]-2-ethylidene-1-N-methylpent-4-ene-1,3-diimine |
|---|---|
| PubChem CID | 138649348 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (2E)-3-N-[(1E,3Z)-8-ethenyl-3-methylcycloocta-1,3-dien-6-yn-1-yl]-2-ethylidene-1-N-methylpent-4-ene-1,3-diimine |
| SMILES | C=CC(=N\C1=C\C(C)=C/CC#CC1C=C)/C(/C=N/C)=C/C |
| InChI | InChI=1S/C19H22N2/c1-6-16-12-10-9-11-15(4)13-19(16)21-18(8-3)17(7-2)14-20-5/h6-8,11,13-14,16H,1,3,9H2,2,4-5H3/b15-11-,17-7+,19-13+,20-14+,21-18+ |
| InChIKey | GHIQNBWMVNFZCI-BSUZQVJUSA-N |
| XLogP | 4.30 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|