About 2-butan-2-ylimidazo[1,2-b]pyridazine
2-butan-2-ylimidazo[1,2-b]pyridazine (PubChem CID 138650085) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-butan-2-ylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 2-butan-2-ylimidazo[1,2-b]pyridazine |
| PubChem CID | 138650085 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-butan-2-ylimidazo[1,2-b]pyridazine |
| SMILES | CCC(C)c1cn2ncccc2n1 |
| InChI | InChI=1S/C10H13N3/c1-3-8(2)9-7-13-10(12-9)5-4-6-11-13/h4-8H,3H2,1-2H3 |
| InChIKey | MEUGGGPHUKIGEF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butan-2-ylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-ylimidazo[1,2-b]pyridazine?
The IUPAC name of 2-butan-2-ylimidazo[1,2-b]pyridazine (CID 138650085) is 2-butan-2-ylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 2-butan-2-ylimidazo[1,2-b]pyridazine?
The canonical SMILES for 2-butan-2-ylimidazo[1,2-b]pyridazine is CCC(C)c1cn2ncccc2n1.
What is the InChIKey of 2-butan-2-ylimidazo[1,2-b]pyridazine?
The InChIKey is MEUGGGPHUKIGEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-3-8(2)9-7-13-10(12-9)5-4-6-11-13/h4-8H,3H2,1-2H3.
What are the key properties of 2-butan-2-ylimidazo[1,2-b]pyridazine?
2-butan-2-ylimidazo[1,2-b]pyridazine has a molecular weight of 175.24 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-ylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 138650085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).