C10H10F6S — CID 138650594
(1E,3Z)-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)hexa-1,3,5-triene-1-thiol (PubChem CID 138650594) has the molecular formula C10H10F6S and a molecular weight of 276.25 g/mol. Its IUPAC name is (1E,3Z)-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)hexa-1,3,5-triene-1-thiol.
| Compound Name | (1E,3Z)-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)hexa-1,3,5-triene-1-thiol |
|---|---|
| PubChem CID | 138650594 |
| Molecular Formula | C10H10F6S |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (1E,3Z)-2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)hexa-1,3,5-triene-1-thiol |
| SMILES | C=C/C=C\C(=C/S)C(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6S/c1-3-4-5-7(6-17)8(2,9(11,12)13)10(14,15)16/h3-6,17H,1H2,2H3/b5-4-,7-6+ |
| InChIKey | WSAQMMLNXXCIRA-SCFJQAPRSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|