C20H37NO — CID 138650640
(E,5E,9E)-5,9,12-trimethyl-N-[(2-methylpropan-2-yl)oxy]trideca-5,9-dien-2-imine (PubChem CID 138650640) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is (E,5E,9E)-5,9,12-trimethyl-N-[(2-methylpropan-2-yl)oxy]trideca-5,9-dien-2-imine.
| Compound Name | (E,5E,9E)-5,9,12-trimethyl-N-[(2-methylpropan-2-yl)oxy]trideca-5,9-dien-2-imine |
|---|---|
| PubChem CID | 138650640 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | (E,5E,9E)-5,9,12-trimethyl-N-[(2-methylpropan-2-yl)oxy]trideca-5,9-dien-2-imine |
| SMILES | C/C(=C\CC(C)C)CC/C=C(\C)CC/C(C)=N/OC(C)(C)C |
| InChI | InChI=1S/C20H37NO/c1-16(2)12-13-17(3)10-9-11-18(4)14-15-19(5)21-22-20(6,7)8/h11,13,16H,9-10,12,14-15H2,1-8H3/b17-13+,18-11+,21-19+ |
| InChIKey | SDMCGIZOQYCEEJ-MKZFFOBQSA-N |
| XLogP | 6.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|