C16H22ClNO3 — CID 138650828
(4R,5S)-4-(2-chloroethyl)-1-[(1S)-1-cyclohex-2-en-1-ylethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 138650828) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is (4R,5S)-4-(2-chloroethyl)-1-[(1S)-1-cyclohex-2-en-1-ylethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (4R,5S)-4-(2-chloroethyl)-1-[(1S)-1-cyclohex-2-en-1-ylethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 138650828 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (4R,5S)-4-(2-chloroethyl)-1-[(1S)-1-cyclohex-2-en-1-ylethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | C[C@@H](C1C=CCCC1)C12NC(=O)[C@H](CCCl)[C@]1(C)OC2=O |
| InChI | InChI=1S/C16H22ClNO3/c1-10(11-6-4-3-5-7-11)16-14(20)21-15(16,2)12(8-9-17)13(19)18-16/h4,6,10-12H,3,5,7-9H2,1-2H3,(H,18,19)/t10-,11?,12-,15-,16?/m0/s1 |
| InChIKey | FYBTUBVCJXQCDH-ACFXOOHZSA-N |
| XLogP | 2.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|