About 5-propan-2-yloxane-2,3,4-tricarboxylic acid
5-propan-2-yloxane-2,3,4-tricarboxylic acid (PubChem CID 138650986) has the molecular formula C11H16O7
and a molecular weight of 260.24 g/mol. Its IUPAC name is 5-propan-2-yloxane-2,3,4-tricarboxylic acid.
Molecular Properties
| Compound Name | 5-propan-2-yloxane-2,3,4-tricarboxylic acid |
| PubChem CID | 138650986 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-propan-2-yloxane-2,3,4-tricarboxylic acid |
| SMILES | CC(C)C1COC(C(=O)O)C(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C11H16O7/c1-4(2)5-3-18-8(11(16)17)7(10(14)15)6(5)9(12)13/h4-8H,3H2,1-2H3,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | MONLIBGJULCNOK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-propan-2-yloxane-2,3,4-tricarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yloxane-2,3,4-tricarboxylic acid?
The IUPAC name of 5-propan-2-yloxane-2,3,4-tricarboxylic acid (CID 138650986) is 5-propan-2-yloxane-2,3,4-tricarboxylic acid.
What is the SMILES notation for 5-propan-2-yloxane-2,3,4-tricarboxylic acid?
The canonical SMILES for 5-propan-2-yloxane-2,3,4-tricarboxylic acid is CC(C)C1COC(C(=O)O)C(C(=O)O)C1C(=O)O.
What is the InChIKey of 5-propan-2-yloxane-2,3,4-tricarboxylic acid?
The InChIKey is MONLIBGJULCNOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O7/c1-4(2)5-3-18-8(11(16)17)7(10(14)15)6(5)9(12)13/h4-8H,3H2,1-2H3,(H,12,13)(H,14,15)(H,16,17).
What are the key properties of 5-propan-2-yloxane-2,3,4-tricarboxylic acid?
5-propan-2-yloxane-2,3,4-tricarboxylic acid has a molecular weight of 260.24 g/mol, XLogP of 0.14, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yloxane-2,3,4-tricarboxylic acid is sourced from PubChem (CID 138650986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).