About bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate
bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate (PubChem CID 138651009) has the molecular formula C48H40F4O4
and a molecular weight of 756.84 g/mol. Its IUPAC name is bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate.
Molecular Properties
| Compound Name | bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate |
| PubChem CID | 138651009 |
| Molecular Formula | C48H40F4O4 |
| Molecular Weight | 756.84 g/mol |
| Exact Mass | 756.29 |
| IUPAC Name | bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate |
| SMILES | CC1CCC(c2cc(F)c(OC(=O)c3ccc4c5cccc6c(C(=O)Oc7c(F)cc(C8CCC(C)CC8)cc7F)ccc(c7cccc3c74)c65)c(F)c2)CC1 |
| InChI | InChI=1S/C48H40F4O4/c1-25-9-13-27(14-10-25)29-21-39(49)45(40(50)22-29)55-47(53)37-19-17-35-32-6-4-8-34-38(20-18-36(44(32)34)31-5-3-7-33(37)43(31)35)48(54)56-46-41(51)23-30(24-42(46)52)28-15-11-26(2)12-16-28/h3-8,17-28H,9-16H2,1-2H3 |
| InChIKey | VHBCZBMDRHQQHQ-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 756.84 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate?
The IUPAC name of bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate (CID 138651009) is bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate.
What is the SMILES notation for bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate?
The canonical SMILES for bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate is CC1CCC(c2cc(F)c(OC(=O)c3ccc4c5cccc6c(C(=O)Oc7c(F)cc(C8CCC(C)CC8)cc7F)ccc(c7cccc3c74)c65)c(F)c2)CC1.
What is the InChIKey of bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate?
The InChIKey is VHBCZBMDRHQQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H40F4O4/c1-25-9-13-27(14-10-25)29-21-39(49)45(40(50)22-29)55-47(53)37-19-17-35-32-6-4-8-34-38(20-18-36(44(32)34)31-5-3-7-33(37)43(31)35)48(54)56-46-41(51)23-30(24-42(46)52)28-15-11-26(2)12-16-28/h3-8,17-28H,9-16H2,1-2H3.
What are the key properties of bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate?
bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate has a molecular weight of 756.84 g/mol, XLogP of 13.32, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2,6-difluoro-4-(4-methylcyclohexyl)phenyl] perylene-3,9-dicarboxylate is sourced from PubChem (CID 138651009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).