C21H27N3O2 — CID 138651245
8-(4-amino-2-methylpentoxy)-2,5,7-trimethylbenzo[c][1,7]naphthyridin-6-one (PubChem CID 138651245) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 8-(4-amino-2-methylpentoxy)-2,5,7-trimethylbenzo[c][1,7]naphthyridin-6-one.
| Compound Name | 8-(4-amino-2-methylpentoxy)-2,5,7-trimethylbenzo[c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 138651245 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 8-(4-amino-2-methylpentoxy)-2,5,7-trimethylbenzo[c][1,7]naphthyridin-6-one |
| SMILES | Cc1cc2c3ccc(OCC(C)CC(C)N)c(C)c3c(=O)n(C)c2cn1 |
| InChI | InChI=1S/C21H27N3O2/c1-12(8-13(2)22)11-26-19-7-6-16-17-9-14(3)23-10-18(17)24(5)21(25)20(16)15(19)4/h6-7,9-10,12-13H,8,11,22H2,1-5H3 |
| InChIKey | YXNAHEZLSARQRF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|