About [(1S,2S)-2-iodocyclopentyl] carbamate
[(1S,2S)-2-iodocyclopentyl] carbamate (PubChem CID 138651300) has the molecular formula C6H10INO2
and a molecular weight of 255.05 g/mol. Its IUPAC name is [(1S,2S)-2-iodocyclopentyl] carbamate.
Molecular Properties
| Compound Name | [(1S,2S)-2-iodocyclopentyl] carbamate |
| PubChem CID | 138651300 |
| Molecular Formula | C6H10INO2 |
| Molecular Weight | 255.05 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | [(1S,2S)-2-iodocyclopentyl] carbamate |
| SMILES | NC(=O)O[C@H]1CCC[C@@H]1I |
| InChI | InChI=1S/C6H10INO2/c7-4-2-1-3-5(4)10-6(8)9/h4-5H,1-3H2,(H2,8,9)/t4-,5-/m0/s1 |
| InChIKey | BOLPEBGISWSAHX-WHFBIAKZSA-N |
| XLogP | 1.44 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.05 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S)-2-iodocyclopentyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-iodocyclopentyl] carbamate?
The IUPAC name of [(1S,2S)-2-iodocyclopentyl] carbamate (CID 138651300) is [(1S,2S)-2-iodocyclopentyl] carbamate.
What is the SMILES notation for [(1S,2S)-2-iodocyclopentyl] carbamate?
The canonical SMILES for [(1S,2S)-2-iodocyclopentyl] carbamate is NC(=O)O[C@H]1CCC[C@@H]1I.
What is the InChIKey of [(1S,2S)-2-iodocyclopentyl] carbamate?
The InChIKey is BOLPEBGISWSAHX-WHFBIAKZSA-N. The full InChI is InChI=1S/C6H10INO2/c7-4-2-1-3-5(4)10-6(8)9/h4-5H,1-3H2,(H2,8,9)/t4-,5-/m0/s1.
What are the key properties of [(1S,2S)-2-iodocyclopentyl] carbamate?
[(1S,2S)-2-iodocyclopentyl] carbamate has a molecular weight of 255.05 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-iodocyclopentyl] carbamate is sourced from PubChem (CID 138651300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).