C42H44F2N4S4 — CID 138651477
2,8-bis[5-[4-(2-ethylhexyl)-2-fluorophenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene (PubChem CID 138651477) has the molecular formula C42H44F2N4S4 and a molecular weight of 771.11 g/mol. Its IUPAC name is 2,8-bis[5-[4-(2-ethylhexyl)-2-fluorophenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene.
| Compound Name | 2,8-bis[5-[4-(2-ethylhexyl)-2-fluorophenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
|---|---|
| PubChem CID | 138651477 |
| Molecular Formula | C42H44F2N4S4 |
| Molecular Weight | 771.11 g/mol |
| Exact Mass | 770.24 |
| IUPAC Name | 2,8-bis[5-[4-(2-ethylhexyl)-2-fluorophenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
| SMILES | CCCCC(CC)Cc1ccc(-c2ccc(-c3c4c(c(-c5ccc(-c6ccc(CC(CC)CCCC)cc6F)s5)c5nsnc35)N=S=N4)s2)c(F)c1 |
| InChI | InChI=1S/C42H44F2N4S4/c1-5-9-11-25(7-3)21-27-13-15-29(31(43)23-27)33-17-19-35(49-33)37-39-41(47-51-45-39)38(42-40(37)46-52-48-42)36-20-18-34(50-36)30-16-14-28(24-32(30)44)22-26(8-4)12-10-6-2/h13-20,23-26H,5-12,21-22H2,1-4H3 |
| InChIKey | KBRYYWHGYBETMF-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.11 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |