About N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide
N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide (PubChem CID 138651636) has the molecular formula C22H43N3O2
and a molecular weight of 381.61 g/mol. Its IUPAC name is N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide.
Molecular Properties
| Compound Name | N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide |
| PubChem CID | 138651636 |
| Molecular Formula | C22H43N3O2 |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 381.34 |
| IUPAC Name | N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide |
| SMILES | C=C(NCCCC)C(CCC(=O)NCCCC)NC(=O)C(CC)CCCC |
| InChI | InChI=1S/C22H43N3O2/c1-6-10-13-19(9-4)22(27)25-20(18(5)23-16-11-7-2)14-15-21(26)24-17-12-8-3/h19-20,23H,5-17H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | AWALYVNJCQTEBU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide?
The IUPAC name of N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide (CID 138651636) is N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide.
What is the SMILES notation for N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide?
The canonical SMILES for N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide is C=C(NCCCC)C(CCC(=O)NCCCC)NC(=O)C(CC)CCCC.
What is the InChIKey of N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide?
The InChIKey is AWALYVNJCQTEBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H43N3O2/c1-6-10-13-19(9-4)22(27)25-20(18(5)23-16-11-7-2)14-15-21(26)24-17-12-8-3/h19-20,23H,5-17H2,1-4H3,(H,24,26)(H,25,27).
What are the key properties of N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide?
N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide has a molecular weight of 381.61 g/mol, XLogP of 4.29, 17 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-bis(butylamino)-6-oxohex-1-en-3-yl]-2-ethylhexanamide is sourced from PubChem (CID 138651636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).