C9H7F3N4O — CID 138651697
4-(2,3,4-trifluoroanilino)-2,5-dihydro-1,2,4-triazin-3-one (PubChem CID 138651697) has the molecular formula C9H7F3N4O and a molecular weight of 244.18 g/mol. Its IUPAC name is 4-(2,3,4-trifluoroanilino)-2,5-dihydro-1,2,4-triazin-3-one.
| Compound Name | 4-(2,3,4-trifluoroanilino)-2,5-dihydro-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 138651697 |
| Molecular Formula | C9H7F3N4O |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-(2,3,4-trifluoroanilino)-2,5-dihydro-1,2,4-triazin-3-one |
| SMILES | O=C1NN=CCN1Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H7F3N4O/c10-5-1-2-6(8(12)7(5)11)15-16-4-3-13-14-9(16)17/h1-3,15H,4H2,(H,14,17) |
| InChIKey | IBFDTWCZNUPQDN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|