About 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine
1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine (PubChem CID 138652436) has the molecular formula C11H20FN
and a molecular weight of 185.29 g/mol. Its IUPAC name is 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine.
Molecular Properties
| Compound Name | 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine |
| PubChem CID | 138652436 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine |
| SMILES | [H]/N=C(\CC)C1C[C@@H](C)CC(C)C1F |
| InChI | InChI=1S/C11H20FN/c1-4-10(13)9-6-7(2)5-8(3)11(9)12/h7-9,11,13H,4-6H2,1-3H3/b13-10+/t7-,8?,9?,11?/m0/s1 |
| InChIKey | QDIIQLCGQAXQJN-LDLBABQGSA-N |
| XLogP | 3.44 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine?
The IUPAC name of 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine (CID 138652436) is 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine.
What is the SMILES notation for 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine?
The canonical SMILES for 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine is [H]/N=C(\CC)C1C[C@@H](C)CC(C)C1F.
What is the InChIKey of 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine?
The InChIKey is QDIIQLCGQAXQJN-LDLBABQGSA-N. The full InChI is InChI=1S/C11H20FN/c1-4-10(13)9-6-7(2)5-8(3)11(9)12/h7-9,11,13H,4-6H2,1-3H3/b13-10+/t7-,8?,9?,11?/m0/s1.
What are the key properties of 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine?
1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine has a molecular weight of 185.29 g/mol, XLogP of 3.44, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5S)-2-fluoro-3,5-dimethylcyclohexyl]propan-1-imine is sourced from PubChem (CID 138652436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).