About 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid
2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid (PubChem CID 138653395) has the molecular formula C12H11Cl3O2
and a molecular weight of 293.58 g/mol. Its IUPAC name is 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid |
| PubChem CID | 138653395 |
| Molecular Formula | C12H11Cl3O2 |
| Molecular Weight | 293.58 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid |
| SMILES | Cc1c(Cl)cc(C2C(C(=O)O)C2(C)Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl3O2/c1-5-7(13)3-6(4-8(5)14)9-10(11(16)17)12(9,2)15/h3-4,9-10H,1-2H3,(H,16,17) |
| InChIKey | OUYLKCXBTFCOKE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid?
The IUPAC name of 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid (CID 138653395) is 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid.
What is the SMILES notation for 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid?
The canonical SMILES for 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid is Cc1c(Cl)cc(C2C(C(=O)O)C2(C)Cl)cc1Cl.
What is the InChIKey of 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid?
The InChIKey is OUYLKCXBTFCOKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl3O2/c1-5-7(13)3-6(4-8(5)14)9-10(11(16)17)12(9,2)15/h3-4,9-10H,1-2H3,(H,16,17).
What are the key properties of 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid?
2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid has a molecular weight of 293.58 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(3,5-dichloro-4-methylphenyl)-2-methylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 138653395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).