About N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine
N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine (PubChem CID 138654347) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine.
Molecular Properties
| Compound Name | N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine |
| PubChem CID | 138654347 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine |
| SMILES | C=CN(C)C(C)(CC)C(C)(CC)CC |
| InChI | InChI=1S/C13H27N/c1-8-12(5,9-2)13(6,10-3)14(7)11-4/h11H,4,8-10H2,1-3,5-7H3 |
| InChIKey | SFWIEVWOOIHCDG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine?
The IUPAC name of N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine (CID 138654347) is N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine.
What is the SMILES notation for N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine?
The canonical SMILES for N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine is C=CN(C)C(C)(CC)C(C)(CC)CC.
What is the InChIKey of N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine?
The InChIKey is SFWIEVWOOIHCDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-8-12(5,9-2)13(6,10-3)14(7)11-4/h11H,4,8-10H2,1-3,5-7H3.
What are the key properties of N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine?
N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine has a molecular weight of 197.37 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-4-ethyl-N,3,4-trimethylhexan-3-amine is sourced from PubChem (CID 138654347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).