About (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one
(2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one (PubChem CID 138654533) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one.
Molecular Properties
| Compound Name | (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one |
| PubChem CID | 138654533 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one |
| SMILES | C=C/C=c1/oc(C2=CCCC=C2)cc(=O)/c1=C/C |
| InChI | InChI=1S/C16H16O2/c1-3-8-15-13(4-2)14(17)11-16(18-15)12-9-6-5-7-10-12/h3-4,6,8-11H,1,5,7H2,2H3/b13-4-,15-8+ |
| InChIKey | DUAUOMDEUWSMOX-RZNXWSPGSA-N |
| XLogP | 2.14 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one?
The IUPAC name of (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one (CID 138654533) is (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one.
What is the SMILES notation for (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one?
The canonical SMILES for (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one is C=C/C=c1/oc(C2=CCCC=C2)cc(=O)/c1=C/C.
What is the InChIKey of (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one?
The InChIKey is DUAUOMDEUWSMOX-RZNXWSPGSA-N. The full InChI is InChI=1S/C16H16O2/c1-3-8-15-13(4-2)14(17)11-16(18-15)12-9-6-5-7-10-12/h3-4,6,8-11H,1,5,7H2,2H3/b13-4-,15-8+.
What are the key properties of (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one?
(2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one has a molecular weight of 240.30 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-6-cyclohexa-1,5-dien-1-yl-3-ethylidene-2-prop-2-enylidenepyran-4-one is sourced from PubChem (CID 138654533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).