C14H26N2 — CID 138654600
1,4-dimethyl-5-nonan-3-ylpyrazole (PubChem CID 138654600) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 1,4-dimethyl-5-nonan-3-ylpyrazole.
| Compound Name | 1,4-dimethyl-5-nonan-3-ylpyrazole |
|---|---|
| PubChem CID | 138654600 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1,4-dimethyl-5-nonan-3-ylpyrazole |
| SMILES | CCCCCCC(CC)c1c(C)cnn1C |
| InChI | InChI=1S/C14H26N2/c1-5-7-8-9-10-13(6-2)14-12(3)11-15-16(14)4/h11,13H,5-10H2,1-4H3 |
| InChIKey | KJSXDOUPIHXTDA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|