C19H24N6 — CID 138654667
4-[7-(4-methylpiperazin-1-yl)-1,4-dihydroquinazolin-2-yl]benzene-1,2-diamine (PubChem CID 138654667) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-[7-(4-methylpiperazin-1-yl)-1,4-dihydroquinazolin-2-yl]benzene-1,2-diamine.
| Compound Name | 4-[7-(4-methylpiperazin-1-yl)-1,4-dihydroquinazolin-2-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 138654667 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 4-[7-(4-methylpiperazin-1-yl)-1,4-dihydroquinazolin-2-yl]benzene-1,2-diamine |
| SMILES | CN1CCN(c2ccc3c(c2)NC(c2ccc(N)c(N)c2)=NC3)CC1 |
| InChI | InChI=1S/C19H24N6/c1-24-6-8-25(9-7-24)15-4-2-14-12-22-19(23-18(14)11-15)13-3-5-16(20)17(21)10-13/h2-5,10-11H,6-9,12,20-21H2,1H3,(H,22,23) |
| InChIKey | WNEXAWJUKKHRJE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|