About (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine
(5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine (PubChem CID 138654886) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine |
| PubChem CID | 138654886 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine |
| SMILES | CC/C=C\C1C/C(=C\CCC)N(C)C1C |
| InChI | InChI=1S/C14H25N/c1-5-7-9-13-11-14(10-8-6-2)15(4)12(13)3/h7,9-10,12-13H,5-6,8,11H2,1-4H3/b9-7-,14-10+ |
| InChIKey | RFPBOPFSSQTVKC-TUZZZSKRSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine?
The IUPAC name of (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine (CID 138654886) is (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine.
What is the SMILES notation for (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine?
The canonical SMILES for (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine is CC/C=C\C1C/C(=C\CCC)N(C)C1C.
What is the InChIKey of (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine?
The InChIKey is RFPBOPFSSQTVKC-TUZZZSKRSA-N. The full InChI is InChI=1S/C14H25N/c1-5-7-9-13-11-14(10-8-6-2)15(4)12(13)3/h7,9-10,12-13H,5-6,8,11H2,1-4H3/b9-7-,14-10+.
What are the key properties of (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine?
(5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine has a molecular weight of 207.36 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3-[(Z)-but-1-enyl]-5-butylidene-1,2-dimethylpyrrolidine is sourced from PubChem (CID 138654886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).