About (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine
(Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine (PubChem CID 138655022) has the molecular formula C6H9F3N2
and a molecular weight of 166.15 g/mol. Its IUPAC name is (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine.
Molecular Properties
| Compound Name | (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine |
| PubChem CID | 138655022 |
| Molecular Formula | C6H9F3N2 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine |
| SMILES | [H]/N=C(\C=C(/N)CC)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2/c1-2-4(10)3-5(11)6(7,8)9/h3,11H,2,10H2,1H3/b4-3-,11-5+ |
| InChIKey | PSZVNMUNBNWOMJ-LDTZZKCISA-N |
| XLogP | 1.82 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine?
The IUPAC name of (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine (CID 138655022) is (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine.
What is the SMILES notation for (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine?
The canonical SMILES for (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine is [H]/N=C(\C=C(/N)CC)C(F)(F)F.
What is the InChIKey of (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine?
The InChIKey is PSZVNMUNBNWOMJ-LDTZZKCISA-N. The full InChI is InChI=1S/C6H9F3N2/c1-2-4(10)3-5(11)6(7,8)9/h3,11H,2,10H2,1H3/b4-3-,11-5+.
What are the key properties of (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine?
(Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine has a molecular weight of 166.15 g/mol, XLogP of 1.82, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6,6,6-trifluoro-5-iminohex-3-en-3-amine is sourced from PubChem (CID 138655022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).