C10H17F3O — CID 138655078
1,1,1-trifluoro-6-methoxy-2,6-dimethylhept-3-ene (PubChem CID 138655078) has the molecular formula C10H17F3O and a molecular weight of 210.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-6-methoxy-2,6-dimethylhept-3-ene.
| Compound Name | 1,1,1-trifluoro-6-methoxy-2,6-dimethylhept-3-ene |
|---|---|
| PubChem CID | 138655078 |
| Molecular Formula | C10H17F3O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1,1,1-trifluoro-6-methoxy-2,6-dimethylhept-3-ene |
| SMILES | COC(C)(C)CC=CC(C)C(F)(F)F |
| InChI | InChI=1S/C10H17F3O/c1-8(10(11,12)13)6-5-7-9(2,3)14-4/h5-6,8H,7H2,1-4H3 |
| InChIKey | CTIHRVXIQICHQK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|