C11H14INS — CID 138655105
2-iodo-3-methyl-4-(5-methylthiophen-2-yl)-2,3,4,5-tetrahydropyridine (PubChem CID 138655105) has the molecular formula C11H14INS and a molecular weight of 319.21 g/mol. Its IUPAC name is 2-iodo-3-methyl-4-(5-methylthiophen-2-yl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 2-iodo-3-methyl-4-(5-methylthiophen-2-yl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 138655105 |
| Molecular Formula | C11H14INS |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 2-iodo-3-methyl-4-(5-methylthiophen-2-yl)-2,3,4,5-tetrahydropyridine |
| SMILES | Cc1ccc(C2CC=NC(I)C2C)s1 |
| InChI | InChI=1S/C11H14INS/c1-7-3-4-10(14-7)9-5-6-13-11(12)8(9)2/h3-4,6,8-9,11H,5H2,1-2H3 |
| InChIKey | KRRGMLDQJUVFEZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|