C23H19Cl2F6N5O — CID 138655141
2-[(4-chloro-2,5-difluorophenyl)-hydroxymethyl]-1-(3-chloro-5-fluorophenyl)-3-[1-cyclopentyl-3-(trifluoromethyl)pyrazol-5-yl]guanidine (PubChem CID 138655141) has the molecular formula C23H19Cl2F6N5O and a molecular weight of 566.33 g/mol. Its IUPAC name is 2-[(4-chloro-2,5-difluorophenyl)-hydroxymethyl]-1-(3-chloro-5-fluorophenyl)-3-[1-cyclopentyl-3-(trifluoromethyl)pyrazol-5-yl]guanidine.
| Compound Name | 2-[(4-chloro-2,5-difluorophenyl)-hydroxymethyl]-1-(3-chloro-5-fluorophenyl)-3-[1-cyclopentyl-3-(trifluoromethyl)pyrazol-5-yl]guanidine |
|---|---|
| PubChem CID | 138655141 |
| Molecular Formula | C23H19Cl2F6N5O |
| Molecular Weight | 566.33 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | 2-[(4-chloro-2,5-difluorophenyl)-hydroxymethyl]-1-(3-chloro-5-fluorophenyl)-3-[1-cyclopentyl-3-(trifluoromethyl)pyrazol-5-yl]guanidine |
| SMILES | OC(/N=C(/Nc1cc(F)cc(Cl)c1)Nc1cc(C(F)(F)F)nn1C1CCCC1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C23H19Cl2F6N5O/c24-11-5-12(26)7-13(6-11)32-22(34-21(37)15-8-18(28)16(25)9-17(15)27)33-20-10-19(23(29,30)31)35-36(20)14-3-1-2-4-14/h5-10,14,21,37H,1-4H2,(H2,32,33,34) |
| InChIKey | YRUGSDLLHPCXBA-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.33 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|