About 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole
4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole (PubChem CID 138655189) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole.
Molecular Properties
| Compound Name | 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole |
| PubChem CID | 138655189 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole |
| SMILES | CC1=C(C(C)(C)C)c2cnn(C)c2CC1 |
| InChI | InChI=1S/C13H20N2/c1-9-6-7-11-10(8-14-15(11)5)12(9)13(2,3)4/h8H,6-7H2,1-5H3 |
| InChIKey | HUICPDAAFNBHFK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole?
The IUPAC name of 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole (CID 138655189) is 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole.
What is the SMILES notation for 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole?
The canonical SMILES for 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole is CC1=C(C(C)(C)C)c2cnn(C)c2CC1.
What is the InChIKey of 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole?
The InChIKey is HUICPDAAFNBHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-9-6-7-11-10(8-14-15(11)5)12(9)13(2,3)4/h8H,6-7H2,1-5H3.
What are the key properties of 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole?
4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole has a molecular weight of 204.32 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,5-dimethyl-6,7-dihydroindazole is sourced from PubChem (CID 138655189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).