C14H23F3N2 — CID 138655232
N-[(3Z)-2,4-dimethyl-5-(trifluoromethyl)hexa-3,5-dien-3-yl]-1-methylpyrrolidin-3-amine (PubChem CID 138655232) has the molecular formula C14H23F3N2 and a molecular weight of 276.35 g/mol. Its IUPAC name is N-[(3Z)-2,4-dimethyl-5-(trifluoromethyl)hexa-3,5-dien-3-yl]-1-methylpyrrolidin-3-amine.
| Compound Name | N-[(3Z)-2,4-dimethyl-5-(trifluoromethyl)hexa-3,5-dien-3-yl]-1-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 138655232 |
| Molecular Formula | C14H23F3N2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-[(3Z)-2,4-dimethyl-5-(trifluoromethyl)hexa-3,5-dien-3-yl]-1-methylpyrrolidin-3-amine |
| SMILES | C=C(/C(C)=C(\NC1CCN(C)C1)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H23F3N2/c1-9(2)13(10(3)11(4)14(15,16)17)18-12-6-7-19(5)8-12/h9,12,18H,4,6-8H2,1-3,5H3/b13-10- |
| InChIKey | KPPBOTYSCJEENH-RAXLEYEMSA-N |
| XLogP | 3.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|