C14H25NO — CID 138655280
(3Z,5Z)-2-[di(propan-2-yl)amino]octa-3,5,7-trien-4-ol (PubChem CID 138655280) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (3Z,5Z)-2-[di(propan-2-yl)amino]octa-3,5,7-trien-4-ol.
| Compound Name | (3Z,5Z)-2-[di(propan-2-yl)amino]octa-3,5,7-trien-4-ol |
|---|---|
| PubChem CID | 138655280 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (3Z,5Z)-2-[di(propan-2-yl)amino]octa-3,5,7-trien-4-ol |
| SMILES | C=C/C=C\C(O)=C\C(C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C14H25NO/c1-7-8-9-14(16)10-13(6)15(11(2)3)12(4)5/h7-13,16H,1H2,2-6H3/b9-8-,14-10- |
| InChIKey | NHONRWUBZNAMNV-GWUHCMQSSA-N |
| XLogP | 3.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|