About 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one
6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one (PubChem CID 138655315) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one.
Molecular Properties
| Compound Name | 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one |
| PubChem CID | 138655315 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2c(N3CCCC3)cc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C17H25N3O/c1-17(2,3)12-10-13-15(19(5)16(21)18(13)4)14(11-12)20-8-6-7-9-20/h10-11H,6-9H2,1-5H3 |
| InChIKey | LGOYMZOWLZSSEU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 30.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one?
The IUPAC name of 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one (CID 138655315) is 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one.
What is the SMILES notation for 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one?
The canonical SMILES for 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one is Cn1c(=O)n(C)c2c(N3CCCC3)cc(C(C)(C)C)cc21.
What is the InChIKey of 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one?
The InChIKey is LGOYMZOWLZSSEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O/c1-17(2,3)12-10-13-15(19(5)16(21)18(13)4)14(11-12)20-8-6-7-9-20/h10-11H,6-9H2,1-5H3.
What are the key properties of 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one?
6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one has a molecular weight of 287.41 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-1,3-dimethyl-4-pyrrolidin-1-ylbenzimidazol-2-one is sourced from PubChem (CID 138655315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).