About 4-tert-butyl-1,5-dimethylindazole
4-tert-butyl-1,5-dimethylindazole (PubChem CID 138655344) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-tert-butyl-1,5-dimethylindazole.
Molecular Properties
| Compound Name | 4-tert-butyl-1,5-dimethylindazole |
| PubChem CID | 138655344 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4-tert-butyl-1,5-dimethylindazole |
| SMILES | Cc1ccc2c(cnn2C)c1C(C)(C)C |
| InChI | InChI=1S/C13H18N2/c1-9-6-7-11-10(8-14-15(11)5)12(9)13(2,3)4/h6-8H,1-5H3 |
| InChIKey | ICZARPMVKCMPSD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-1,5-dimethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,5-dimethylindazole?
The IUPAC name of 4-tert-butyl-1,5-dimethylindazole (CID 138655344) is 4-tert-butyl-1,5-dimethylindazole.
What is the SMILES notation for 4-tert-butyl-1,5-dimethylindazole?
The canonical SMILES for 4-tert-butyl-1,5-dimethylindazole is Cc1ccc2c(cnn2C)c1C(C)(C)C.
What is the InChIKey of 4-tert-butyl-1,5-dimethylindazole?
The InChIKey is ICZARPMVKCMPSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-9-6-7-11-10(8-14-15(11)5)12(9)13(2,3)4/h6-8H,1-5H3.
What are the key properties of 4-tert-butyl-1,5-dimethylindazole?
4-tert-butyl-1,5-dimethylindazole has a molecular weight of 202.30 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,5-dimethylindazole is sourced from PubChem (CID 138655344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).