C24H33NO5 — CID 138655524
(1S,2S,3S,4S,7R,10R,13S,17S)-13,17-dihydroxy-N-(4-hydroxybutyl)-4-methyl-14-methylidene-5-oxopentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide (PubChem CID 138655524) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is (1S,2S,3S,4S,7R,10R,13S,17S)-13,17-dihydroxy-N-(4-hydroxybutyl)-4-methyl-14-methylidene-5-oxopentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide.
| Compound Name | (1S,2S,3S,4S,7R,10R,13S,17S)-13,17-dihydroxy-N-(4-hydroxybutyl)-4-methyl-14-methylidene-5-oxopentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide |
|---|---|
| PubChem CID | 138655524 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | (1S,2S,3S,4S,7R,10R,13S,17S)-13,17-dihydroxy-N-(4-hydroxybutyl)-4-methyl-14-methylidene-5-oxopentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide |
| SMILES | C=C1C[C@]23C[C@@]1(O)CC[C@H]2C1=C[C@H]2CC(=O)[C@@](C)([C@H]1[C@@H]3C(=O)NCCCCO)[C@H]2O |
| InChI | InChI=1S/C24H33NO5/c1-13-11-23-12-24(13,30)6-5-16(23)15-9-14-10-17(27)22(2,20(14)28)18(15)19(23)21(29)25-7-3-4-8-26/h9,14,16,18-20,26,28,30H,1,3-8,10-12H2,2H3,(H,25,29)/t14-,16-,18+,19+,20-,22-,23-,24-/m0/s1 |
| InChIKey | WEAJXDGACJRICS-WXYDPBAISA-N |
| XLogP | 1.49 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|