C19H22O6 — CID 138655567
(1S,2S,3R,4S,5S,8R,9R,12S)-5,8,12-trihydroxy-4-methyl-13-methylidene-16-oxopentacyclo[10.2.1.14,7.01,9.03,8]hexadec-6-ene-2-carboxylic acid (PubChem CID 138655567) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is (1S,2S,3R,4S,5S,8R,9R,12S)-5,8,12-trihydroxy-4-methyl-13-methylidene-16-oxopentacyclo[10.2.1.14,7.01,9.03,8]hexadec-6-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4S,5S,8R,9R,12S)-5,8,12-trihydroxy-4-methyl-13-methylidene-16-oxopentacyclo[10.2.1.14,7.01,9.03,8]hexadec-6-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 138655567 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (1S,2S,3R,4S,5S,8R,9R,12S)-5,8,12-trihydroxy-4-methyl-13-methylidene-16-oxopentacyclo[10.2.1.14,7.01,9.03,8]hexadec-6-ene-2-carboxylic acid |
| SMILES | C=C1C[C@]23C[C@@]1(O)CC[C@H]2[C@]1(O)C2=C[C@H](O)[C@@](C)(C2=O)[C@H]1[C@@H]3C(=O)O |
| InChI | InChI=1S/C19H22O6/c1-8-6-17-7-18(8,24)4-3-10(17)19(25)9-5-11(20)16(2,14(9)21)13(19)12(17)15(22)23/h5,10-13,20,24-25H,1,3-4,6-7H2,2H3,(H,22,23)/t10-,11+,12-,13-,16-,17+,18+,19-/m1/s1 |
| InChIKey | SHGRQMAKDNSOKE-OBDJNFEBSA-N |
| XLogP | 0.42 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|