C13H22N2 — CID 138656040
(4Z,6Z)-2,9-dimethyl-N-(methylideneamino)deca-2,4,6-trien-3-amine (PubChem CID 138656040) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (4Z,6Z)-2,9-dimethyl-N-(methylideneamino)deca-2,4,6-trien-3-amine.
| Compound Name | (4Z,6Z)-2,9-dimethyl-N-(methylideneamino)deca-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 138656040 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (4Z,6Z)-2,9-dimethyl-N-(methylideneamino)deca-2,4,6-trien-3-amine |
| SMILES | C=NNC(/C=C\C=C/CC(C)C)=C(C)C |
| InChI | InChI=1S/C13H22N2/c1-11(2)9-7-6-8-10-13(12(3)4)15-14-5/h6-8,10-11,15H,5,9H2,1-4H3/b7-6-,10-8- |
| InChIKey | FBXNVGQCGXGDRL-INZNQPOWSA-N |
| XLogP | 3.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|