About 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole
3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole (PubChem CID 138656366) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole |
| PubChem CID | 138656366 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole |
| SMILES | CC(C)C(C)CCc1nncn1C |
| InChI | InChI=1S/C10H19N3/c1-8(2)9(3)5-6-10-12-11-7-13(10)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | IVFFGYMRWNPGQX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole?
The IUPAC name of 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole (CID 138656366) is 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole.
What is the SMILES notation for 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole?
The canonical SMILES for 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole is CC(C)C(C)CCc1nncn1C.
What is the InChIKey of 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole?
The InChIKey is IVFFGYMRWNPGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-8(2)9(3)5-6-10-12-11-7-13(10)4/h7-9H,5-6H2,1-4H3.
What are the key properties of 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole?
3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole has a molecular weight of 181.28 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylpentyl)-4-methyl-1,2,4-triazole is sourced from PubChem (CID 138656366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).