About 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one
4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one (PubChem CID 138656547) has the molecular formula C21H20N2O4
and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one |
| PubChem CID | 138656547 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one |
| SMILES | CC(Oc1cc(-c2ccc(O)c(O)c2)cc2ncccc12)C1CNC(=O)C1 |
| InChI | InChI=1S/C21H20N2O4/c1-12(15-10-21(26)23-11-15)27-20-9-14(7-17-16(20)3-2-6-22-17)13-4-5-18(24)19(25)8-13/h2-9,12,15,24-25H,10-11H2,1H3,(H,23,26) |
| InChIKey | DUBYYAFFLFSYAI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one?
The IUPAC name of 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one (CID 138656547) is 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one.
What is the SMILES notation for 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one?
The canonical SMILES for 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one is CC(Oc1cc(-c2ccc(O)c(O)c2)cc2ncccc12)C1CNC(=O)C1.
What is the InChIKey of 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one?
The InChIKey is DUBYYAFFLFSYAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O4/c1-12(15-10-21(26)23-11-15)27-20-9-14(7-17-16(20)3-2-6-22-17)13-4-5-18(24)19(25)8-13/h2-9,12,15,24-25H,10-11H2,1H3,(H,23,26).
What are the key properties of 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one?
4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one has a molecular weight of 364.40 g/mol, XLogP of 3.22, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[7-(3,4-dihydroxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one is sourced from PubChem (CID 138656547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).