C25H25ClN2O4 — CID 138656592
2-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-N-(4-methylphenyl)butanamide (PubChem CID 138656592) has the molecular formula C25H25ClN2O4 and a molecular weight of 452.94 g/mol. Its IUPAC name is 2-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-N-(4-methylphenyl)butanamide.
| Compound Name | 2-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-N-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 138656592 |
| Molecular Formula | C25H25ClN2O4 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-[4-(2-acetyl-5-chlorophenyl)-5-methoxy-2-oxo-1-pyridinyl]-N-(4-methylphenyl)butanamide |
| SMILES | CCC(C(=O)Nc1ccc(C)cc1)n1cc(OC)c(-c2cc(Cl)ccc2C(C)=O)cc1=O |
| InChI | InChI=1S/C25H25ClN2O4/c1-5-22(25(31)27-18-9-6-15(2)7-10-18)28-14-23(32-4)21(13-24(28)30)20-12-17(26)8-11-19(20)16(3)29/h6-14,22H,5H2,1-4H3,(H,27,31) |
| InChIKey | QFZJLTZEZARJCY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |