C25H37NO5 — CID 138657106
5-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-2-[3-[1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclopropyl]oxyprop-1-ynyl]pyridine (PubChem CID 138657106) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is 5-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-2-[3-[1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclopropyl]oxyprop-1-ynyl]pyridine.
| Compound Name | 5-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-2-[3-[1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclopropyl]oxyprop-1-ynyl]pyridine |
|---|---|
| PubChem CID | 138657106 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 5-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-2-[3-[1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclopropyl]oxyprop-1-ynyl]pyridine |
| SMILES | CC(C)(C)OCCOC1(OCC#Cc2ccc(OC3CC(OC(C)(C)C)C3)cn2)CC1 |
| InChI | InChI=1S/C25H37NO5/c1-23(2,3)27-14-15-29-25(11-12-25)28-13-7-8-19-9-10-20(18-26-19)30-21-16-22(17-21)31-24(4,5)6/h9-10,18,21-22H,11-17H2,1-6H3 |
| InChIKey | NSOBGEMIQVQOEM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|