C20H21N3O4 — CID 138657775
(8R)-8-tert-butyl-13-methoxy-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid (PubChem CID 138657775) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (8R)-8-tert-butyl-13-methoxy-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid.
| Compound Name | (8R)-8-tert-butyl-13-methoxy-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 138657775 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (8R)-8-tert-butyl-13-methoxy-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid |
| SMILES | COc1cccc2c3n(nc12)C[C@@H](C(C)(C)C)n1cc(C(=O)O)c(=O)cc1-3 |
| InChI | InChI=1S/C20H21N3O4/c1-20(2,3)16-10-23-18(11-6-5-7-15(27-4)17(11)21-23)13-8-14(24)12(19(25)26)9-22(13)16/h5-9,16H,10H2,1-4H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | RPOKFEFPUKSGKT-INIZCTEOSA-N |
| XLogP | 3.17 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |