C31H55NO — CID 138658038
5-[[(4S,9E)-3,12-dimethyl-8-methylidene-10-propyltrideca-9,12-dien-4-yl]-[(Z)-hept-5-enyl]amino]pentanal (PubChem CID 138658038) has the molecular formula C31H55NO and a molecular weight of 457.79 g/mol. Its IUPAC name is 5-[[(4S,9E)-3,12-dimethyl-8-methylidene-10-propyltrideca-9,12-dien-4-yl]-[(Z)-hept-5-enyl]amino]pentanal.
| Compound Name | 5-[[(4S,9E)-3,12-dimethyl-8-methylidene-10-propyltrideca-9,12-dien-4-yl]-[(Z)-hept-5-enyl]amino]pentanal |
|---|---|
| PubChem CID | 138658038 |
| Molecular Formula | C31H55NO |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.43 |
| IUPAC Name | 5-[[(4S,9E)-3,12-dimethyl-8-methylidene-10-propyltrideca-9,12-dien-4-yl]-[(Z)-hept-5-enyl]amino]pentanal |
| SMILES | C=C(C)C/C(=C/C(=C)CCC[C@@H](C(C)CC)N(CCCCC=O)CCCC/C=C\C)CCC |
| InChI | InChI=1S/C31H55NO/c1-8-11-12-13-15-22-32(23-16-14-17-24-33)31(29(7)10-3)21-18-20-28(6)26-30(19-9-2)25-27(4)5/h8,11,24,26,29,31H,4,6,9-10,12-23,25H2,1-3,5,7H3/b11-8-,30-26+/t29?,31-/m0/s1 |
| InChIKey | VYZRTOMGLXTQAE-FPHZSONSSA-N |
| XLogP | 9.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|