C28H36ClN7O — CID 138658285
(E)-N-[5-[3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]hex-5-enyl]-4-(dimethylamino)but-2-enamide (PubChem CID 138658285) has the molecular formula C28H36ClN7O and a molecular weight of 522.10 g/mol. Its IUPAC name is (E)-N-[5-[3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]hex-5-enyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[5-[3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]hex-5-enyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 138658285 |
| Molecular Formula | C28H36ClN7O |
| Molecular Weight | 522.10 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | (E)-N-[5-[3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]hex-5-enyl]-4-(dimethylamino)but-2-enamide |
| SMILES | C=C(CCCCNC(=O)/C=C/CN(C)C)N1CCC(Nc2ncc(Cl)c(-c3c[nH]c4ccccc34)n2)C1 |
| InChI | InChI=1S/C28H36ClN7O/c1-20(9-6-7-14-30-26(37)12-8-15-35(2)3)36-16-13-21(19-36)33-28-32-18-24(29)27(34-28)23-17-31-25-11-5-4-10-22(23)25/h4-5,8,10-12,17-18,21,31H,1,6-7,9,13-16,19H2,2-3H3,(H,30,37)(H,32,33,34)/b12-8+ |
| InChIKey | VNMSGUMNKPXHLR-XYOKQWHBSA-N |
| XLogP | 4.68 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.10 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|