C22H17ClN2O3 — CID 138658390
ethyl 2-(3-chloro-9-oxo-4-pyridin-3-ylacridin-10-yl)acetate (PubChem CID 138658390) has the molecular formula C22H17ClN2O3 and a molecular weight of 392.84 g/mol. Its IUPAC name is ethyl 2-(3-chloro-9-oxo-4-pyridin-3-ylacridin-10-yl)acetate.
| Compound Name | ethyl 2-(3-chloro-9-oxo-4-pyridin-3-ylacridin-10-yl)acetate |
|---|---|
| PubChem CID | 138658390 |
| Molecular Formula | C22H17ClN2O3 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | ethyl 2-(3-chloro-9-oxo-4-pyridin-3-ylacridin-10-yl)acetate |
| SMILES | CCOC(=O)Cn1c2ccccc2c(=O)c2ccc(Cl)c(-c3cccnc3)c21 |
| InChI | InChI=1S/C22H17ClN2O3/c1-2-28-19(26)13-25-18-8-4-3-7-15(18)22(27)16-9-10-17(23)20(21(16)25)14-6-5-11-24-12-14/h3-12H,2,13H2,1H3 |
| InChIKey | VYSMGZGMXTUITJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|