C23H23Cl2NO3 — CID 138658416
2-[3,4-dichloro-6-(4,4-dimethylcyclohexyl)-9-oxoacridin-10-yl]acetic acid (PubChem CID 138658416) has the molecular formula C23H23Cl2NO3 and a molecular weight of 432.35 g/mol. Its IUPAC name is 2-[3,4-dichloro-6-(4,4-dimethylcyclohexyl)-9-oxoacridin-10-yl]acetic acid.
| Compound Name | 2-[3,4-dichloro-6-(4,4-dimethylcyclohexyl)-9-oxoacridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 138658416 |
| Molecular Formula | C23H23Cl2NO3 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-[3,4-dichloro-6-(4,4-dimethylcyclohexyl)-9-oxoacridin-10-yl]acetic acid |
| SMILES | CC1(C)CCC(c2ccc3c(=O)c4ccc(Cl)c(Cl)c4n(CC(=O)O)c3c2)CC1 |
| InChI | InChI=1S/C23H23Cl2NO3/c1-23(2)9-7-13(8-10-23)14-3-4-15-18(11-14)26(12-19(27)28)21-16(22(15)29)5-6-17(24)20(21)25/h3-6,11,13H,7-10,12H2,1-2H3,(H,27,28) |
| InChIKey | VTWRQUSVUPYVFO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|