C25H21ClN2O2S — CID 138659038
10-[[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]methyl]-6,7,8,9-tetrahydropyrido[1,2-a]indole-7-carboxylic acid (PubChem CID 138659038) has the molecular formula C25H21ClN2O2S and a molecular weight of 448.98 g/mol. Its IUPAC name is 10-[[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]methyl]-6,7,8,9-tetrahydropyrido[1,2-a]indole-7-carboxylic acid.
| Compound Name | 10-[[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]methyl]-6,7,8,9-tetrahydropyrido[1,2-a]indole-7-carboxylic acid |
|---|---|
| PubChem CID | 138659038 |
| Molecular Formula | C25H21ClN2O2S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 10-[[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]methyl]-6,7,8,9-tetrahydropyrido[1,2-a]indole-7-carboxylic acid |
| SMILES | O=C(O)C1CCc2c(Cc3cccnc3Sc3ccc(Cl)cc3)c3ccccc3n2C1 |
| InChI | InChI=1S/C25H21ClN2O2S/c26-18-8-10-19(11-9-18)31-24-16(4-3-13-27-24)14-21-20-5-1-2-6-22(20)28-15-17(25(29)30)7-12-23(21)28/h1-6,8-11,13,17H,7,12,14-15H2,(H,29,30) |
| InChIKey | SCZXQEXFXFEHCV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|