C36H40O11S — CID 138659175
[3-[(4S)-4-[1-(benzenesulfonyl)-2-oxobut-3-enyl]-5-(2,2-dimethoxyethyl)-3-methoxyoxolan-2-yl]-2-benzoyloxypropyl] benzoate (PubChem CID 138659175) has the molecular formula C36H40O11S and a molecular weight of 680.77 g/mol. Its IUPAC name is [3-[(4S)-4-[1-(benzenesulfonyl)-2-oxobut-3-enyl]-5-(2,2-dimethoxyethyl)-3-methoxyoxolan-2-yl]-2-benzoyloxypropyl] benzoate.
| Compound Name | [3-[(4S)-4-[1-(benzenesulfonyl)-2-oxobut-3-enyl]-5-(2,2-dimethoxyethyl)-3-methoxyoxolan-2-yl]-2-benzoyloxypropyl] benzoate |
|---|---|
| PubChem CID | 138659175 |
| Molecular Formula | C36H40O11S |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.23 |
| IUPAC Name | [3-[(4S)-4-[1-(benzenesulfonyl)-2-oxobut-3-enyl]-5-(2,2-dimethoxyethyl)-3-methoxyoxolan-2-yl]-2-benzoyloxypropyl] benzoate |
| SMILES | C=CC(=O)C([C@H]1C(CC(OC)OC)OC(CC(COC(=O)c2ccccc2)OC(=O)c2ccccc2)C1OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H40O11S/c1-5-28(37)34(48(40,41)27-19-13-8-14-20-27)32-29(22-31(42-2)43-3)47-30(33(32)44-4)21-26(46-36(39)25-17-11-7-12-18-25)23-45-35(38)24-15-9-6-10-16-24/h5-20,26,29-34H,1,21-23H2,2-4H3/t26?,29?,30?,32-,33?,34?/m0/s1 |
| InChIKey | FSMDNSTUDIWUMX-FAXGVLKSSA-N |
| XLogP | 4.46 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|