C22H30O8 — CID 138659246
methyl 2-[(1S,3S,4R,5R,7S,8S,9R,11R)-4,8-dihydroxy-5-(2-phenylmethoxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate (PubChem CID 138659246) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is methyl 2-[(1S,3S,4R,5R,7S,8S,9R,11R)-4,8-dihydroxy-5-(2-phenylmethoxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate.
| Compound Name | methyl 2-[(1S,3S,4R,5R,7S,8S,9R,11R)-4,8-dihydroxy-5-(2-phenylmethoxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
|---|---|
| PubChem CID | 138659246 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | methyl 2-[(1S,3S,4R,5R,7S,8S,9R,11R)-4,8-dihydroxy-5-(2-phenylmethoxyethyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2O[C@H]3[C@H](O)[C@@H](CCOCc4ccccc4)O[C@H]3[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C22H30O8/c1-26-17(23)11-14-7-8-16-20(28-14)19(25)22-21(30-16)18(24)15(29-22)9-10-27-12-13-5-3-2-4-6-13/h2-6,14-16,18-22,24-25H,7-12H2,1H3/t14-,15-,16+,18-,19+,20+,21+,22+/m1/s1 |
| InChIKey | BDMFMNSDCUJPBT-NWXCXGFVSA-N |
| XLogP | 0.96 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|