C15H20F4N2O — CID 138659249
1-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-3-[(2Z,4E)-5-(trifluoromethyl)hepta-2,4-dienyl]urea (PubChem CID 138659249) has the molecular formula C15H20F4N2O and a molecular weight of 320.33 g/mol. Its IUPAC name is 1-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-3-[(2Z,4E)-5-(trifluoromethyl)hepta-2,4-dienyl]urea.
| Compound Name | 1-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-3-[(2Z,4E)-5-(trifluoromethyl)hepta-2,4-dienyl]urea |
|---|---|
| PubChem CID | 138659249 |
| Molecular Formula | C15H20F4N2O |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]-3-[(2Z,4E)-5-(trifluoromethyl)hepta-2,4-dienyl]urea |
| SMILES | C/C=C\C(NC(=O)NC/C=C\C=C(/CC)C(F)(F)F)=C(/C)F |
| InChI | InChI=1S/C15H20F4N2O/c1-4-8-13(11(3)16)21-14(22)20-10-7-6-9-12(5-2)15(17,18)19/h4,6-9H,5,10H2,1-3H3,(H2,20,21,22)/b7-6-,8-4-,12-9+,13-11- |
| InChIKey | TVNSBBJIAGJHEY-NPTCDFFASA-N |
| XLogP | 4.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|