C21H28O4S — CID 138659556
(3R)-1-[(2S,5R)-5-[2-(benzenesulfonyl)ethyl]-3-methylideneoxolan-2-yl]-5-methylhepta-5,6-dien-3-ol (PubChem CID 138659556) has the molecular formula C21H28O4S and a molecular weight of 376.52 g/mol. Its IUPAC name is (3R)-1-[(2S,5R)-5-[2-(benzenesulfonyl)ethyl]-3-methylideneoxolan-2-yl]-5-methylhepta-5,6-dien-3-ol.
| Compound Name | (3R)-1-[(2S,5R)-5-[2-(benzenesulfonyl)ethyl]-3-methylideneoxolan-2-yl]-5-methylhepta-5,6-dien-3-ol |
|---|---|
| PubChem CID | 138659556 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (3R)-1-[(2S,5R)-5-[2-(benzenesulfonyl)ethyl]-3-methylideneoxolan-2-yl]-5-methylhepta-5,6-dien-3-ol |
| SMILES | C=C=C(C)C[C@H](O)CC[C@@H]1O[C@@H](CCS(=O)(=O)c2ccccc2)CC1=C |
| InChI | InChI=1S/C21H28O4S/c1-4-16(2)14-18(22)10-11-21-17(3)15-19(25-21)12-13-26(23,24)20-8-6-5-7-9-20/h5-9,18-19,21-22H,1,3,10-15H2,2H3/t18-,19+,21+/m1/s1 |
| InChIKey | PSSHGMPCJDKXEA-DYXWJJEUSA-N |
| XLogP | 3.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|