About 6-iminohex-3-en-2-amine
6-iminohex-3-en-2-amine (PubChem CID 138659587) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 6-iminohex-3-en-2-amine.
Molecular Properties
| Compound Name | 6-iminohex-3-en-2-amine |
| PubChem CID | 138659587 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 6-iminohex-3-en-2-amine |
| SMILES | [H]/N=C/CC=CC(C)N |
| InChI | InChI=1S/C6H12N2/c1-6(8)4-2-3-5-7/h2,4-7H,3,8H2,1H3/b4-2?,7-5+ |
| InChIKey | PRFQYOSMIYHKOM-LWIMGRHQSA-N |
| XLogP | 0.93 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-iminohex-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iminohex-3-en-2-amine?
The IUPAC name of 6-iminohex-3-en-2-amine (CID 138659587) is 6-iminohex-3-en-2-amine.
What is the SMILES notation for 6-iminohex-3-en-2-amine?
The canonical SMILES for 6-iminohex-3-en-2-amine is [H]/N=C/CC=CC(C)N.
What is the InChIKey of 6-iminohex-3-en-2-amine?
The InChIKey is PRFQYOSMIYHKOM-LWIMGRHQSA-N. The full InChI is InChI=1S/C6H12N2/c1-6(8)4-2-3-5-7/h2,4-7H,3,8H2,1H3/b4-2?,7-5+.
What are the key properties of 6-iminohex-3-en-2-amine?
6-iminohex-3-en-2-amine has a molecular weight of 112.18 g/mol, XLogP of 0.93, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iminohex-3-en-2-amine is sourced from PubChem (CID 138659587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).